cas: 2349372-98-9 — see every product listed under this CAS number, including other names
PD-1-IN-22 (CAS 2349372-98-9) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch135BPW-1mg |
| cas | 2349372-98-9 |
| size | 1mg |
| availability | 0.5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 587.60 Pln | |
| Chemat | 2mg | 846.80 Pln | |
| Chemat | 5mg | 1288.40 Pln | |
| Chemat | 10mg | 1864.40 Pln | |
| Chemat | 25mg | 2906.00 Pln | |
| Chemat | 50mg | 3966.80 Pln | |
| Chemat | 100mg | 5344.40 Pln | |
| Chemat | 500mg | 10595.60 Pln |
| delivery time | 3 weeks |
|---|
N-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]-6-[(2-hydroxyethylamino)methyl]-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide (CAS 2349372-98-9) is a chemical compound with the molecular formula C25H25N5O4 and a molecular weight of 459.5 g/mol. IUPAC name: N-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]-6-[(2-hydroxyethylamino)methyl]-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide. InChIKey: IWOBHQNCHHSQSY-UHFFFAOYSA-N.
| Molecular formula | C25H25N5O4 |
|---|---|
| Molecular weight | 459.5 g/mol |
| IUPAC name | N-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]-6-[(2-hydroxyethylamino)methyl]-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide |
| InChIKey | IWOBHQNCHHSQSY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1NC(=O)C2=CC(=CN3C2=NN=C3)CNCCO)C4=CC5=C(C=C4)OCCO5 |
Computed by PubChem (NCBI)