Products 2560590-49-8
CAS 2560590-49-8 is the registry number for Topoisomerase II inhibitor 4. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-hydroxy-1-[4-[(4-methylpiperazin-1-yl)methyl]anilino]-4-nitro-10H-acridin-9-one (CAS 2560590-49-8) is a chemical compound with the molecular formula C25H25N5O4 and a molecular weight of 459.5 g/mol. IUPAC name: 7-hydroxy-1-[4-[(4-methylpiperazin-1-yl)methyl]anilino]-4-nitro-10H-acridin-9-one. InChIKey: JWQPGKCTVPZVGK-UHFFFAOYSA-N.
| Molecular formula | C25H25N5O4 |
|---|---|
| Molecular weight | 459.5 g/mol |
| IUPAC name | 7-hydroxy-1-[4-[(4-methylpiperazin-1-yl)methyl]anilino]-4-nitro-10H-acridin-9-one |
| InChIKey | JWQPGKCTVPZVGK-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CC2=CC=C(C=C2)NC3=C4C(=C(C=C3)[N+](=O)[O-])NC5=C(C4=O)C=C(C=C5)O |
Computed by PubChem (NCBI)
Synonyms:
Topoisomerase II inhibitor 4, orb1687155