cas: 199850-67-4 — see every product listed under this CAS number, including other names
PD-166793 95% (CAS 199850-67-4) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A395571-5mg |
| cas | 199850-67-4 |
| size | 5mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5mg | 492.75 Pln | |
| Ambeed | 10mg | 720.81 Pln | |
| Ambeed | 25mg | 1405.00 Pln | |
| Ambeed | 50mg | 1939.00 Pln | |
| Ambeed | 100mg | 2689.94 Pln | |
| Ambeed | 250mg | 4358.69 Pln | |
| Ambeed | 1g | 7368.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A395571 |
(2S)-2-[[4-(4-bromophenyl)phenyl]sulfonylamino]-3-methylbutanoic acid (CAS 199850-67-4) is a chemical compound with the molecular formula C17H18BrNO4S and a molecular weight of 412.3 g/mol. IUPAC name: (2S)-2-[[4-(4-bromophenyl)phenyl]sulfonylamino]-3-methylbutanoic acid. InChIKey: GJOCABIDMCKCEG-INIZCTEOSA-N.
| Molecular formula | C17H18BrNO4S |
|---|---|
| Molecular weight | 412.3 g/mol |
| IUPAC name | (2S)-2-[[4-(4-bromophenyl)phenyl]sulfonylamino]-3-methylbutanoic acid |
| InChIKey | GJOCABIDMCKCEG-INIZCTEOSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NS(=O)(=O)C1=CC=C(C=C1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)