CAS 199850-67-4 appears in our catalog under these names: (S)-2-(4'-Bromo-[1,1'-biphenyl]-4-ylsulfonamido)-3-methylbutanoic acid, 95%, 95%, PD 166793, PD-166793/ 100%, PD 166793, PD-166793 95%. Offered by: Chemat, TRC, TargetMol, GLPBio, Ambeed. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 2mg, 500mg.
(2S)-2-[[4-(4-bromophenyl)phenyl]sulfonylamino]-3-methylbutanoic acid (CAS 199850-67-4) is a chemical compound with the molecular formula C17H18BrNO4S and a molecular weight of 412.3 g/mol. IUPAC name: (2S)-2-[[4-(4-bromophenyl)phenyl]sulfonylamino]-3-methylbutanoic acid. InChIKey: GJOCABIDMCKCEG-INIZCTEOSA-N.
| Molecular formula | C17H18BrNO4S |
|---|---|
| Molecular weight | 412.3 g/mol |
| IUPAC name | (2S)-2-[[4-(4-bromophenyl)phenyl]sulfonylamino]-3-methylbutanoic acid |
| InChIKey | GJOCABIDMCKCEG-INIZCTEOSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NS(=O)(=O)C1=CC=C(C=C1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)