CAS 2953044-29-4 appears in our catalog under these names: 2-((4-(aminomethyl)benzyl)oxy)-4-(4-fluorophenyl)thiophene-3-carbonitrile hydrochloride, 95%, 95%, PD-L1-IN-3/ 99.47% (existing batch purity), PD–L1–IN–3, PD-L1-IN-3, 99.69%. Offered by: Chemat, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 1mg, 50mg, 100mg, 25 mg, 100 mg.
2-[[4-(aminomethyl)phenyl]methoxy]-4-(4-fluorophenyl)thiophene-3-carbonitrile;hydrochloride (CAS 2953044-29-4) is a chemical compound with the molecular formula C19H16ClFN2OS and a molecular weight of 374.9 g/mol. IUPAC name: 2-[[4-(aminomethyl)phenyl]methoxy]-4-(4-fluorophenyl)thiophene-3-carbonitrile;hydrochloride. InChIKey: ARPPMPJCLFWQEY-UHFFFAOYSA-N.
| Molecular formula | C19H16ClFN2OS |
|---|---|
| Molecular weight | 374.9 g/mol |
| IUPAC name | 2-[[4-(aminomethyl)phenyl]methoxy]-4-(4-fluorophenyl)thiophene-3-carbonitrile;hydrochloride |
| InChIKey | ARPPMPJCLFWQEY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)COC2=C(C(=CS2)C3=CC=C(C=C3)F)C#N.Cl |
Computed by PubChem (NCBI)