CAS 391210-00-7 appears in our catalog under these names: PD318088/ 99.81% (existing batch purity), PD318088, PD318088 99%, PD318088, 99%, 99%, PD318088, 99.82%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 250mg.
5-bromo-N-(2,3-dihydroxypropoxy)-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide (CAS 391210-00-7) is a chemical compound with the molecular formula C16H13BrF3IN2O4 and a molecular weight of 561.09 g/mol. IUPAC name: 5-bromo-N-(2,3-dihydroxypropoxy)-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide. InChIKey: XXSSGBYXSKOLAM-UHFFFAOYSA-N.
| Molecular formula | C16H13BrF3IN2O4 |
|---|---|
| Molecular weight | 561.09 g/mol |
| IUPAC name | 5-bromo-N-(2,3-dihydroxypropoxy)-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
| InChIKey | XXSSGBYXSKOLAM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1I)F)NC2=C(C(=C(C=C2C(=O)NOCC(CO)O)Br)F)F |
Computed by PubChem (NCBI)