CAS 915082-52-9 appears in our catalog under these names: PDE4B-IN-2/ 99.37% (existing batch purity), A 33, A 33, PDE4B-IN-2 99%, PDE4B-IN-2, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 100 mg.
2-[4-[[2-(5-chlorothiophen-2-yl)-5-ethyl-6-methylpyrimidin-4-yl]amino]phenyl]acetic acid (CAS 915082-52-9) is a chemical compound with the molecular formula C19H18ClN3O2S and a molecular weight of 387.9 g/mol. IUPAC name: 2-[4-[[2-(5-chlorothiophen-2-yl)-5-ethyl-6-methylpyrimidin-4-yl]amino]phenyl]acetic acid. InChIKey: FDVSPBLZPJMXFV-UHFFFAOYSA-N.
| Molecular formula | C19H18ClN3O2S |
|---|---|
| Molecular weight | 387.9 g/mol |
| IUPAC name | 2-[4-[[2-(5-chlorothiophen-2-yl)-5-ethyl-6-methylpyrimidin-4-yl]amino]phenyl]acetic acid |
| InChIKey | FDVSPBLZPJMXFV-UHFFFAOYSA-N |
| SMILES | CCC1=C(N=C(N=C1NC2=CC=C(C=C2)CC(=O)O)C3=CC=C(S3)Cl)C |
Computed by PubChem (NCBI)