CAS 2904682-19-3 appears in our catalog under these names: PDS-0330/ 99.93% (existing batch purity), PDS–0330, N-((4-(Benzo[d]oxazol-2-yl)phenyl)carbamothioyl)-2-naphthamide, 95%, 95%, PDS-0330, 99.77%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10 mg.
N-[[4-(1,3-benzoxazol-2-yl)phenyl]carbamothioyl]naphthalene-2-carboxamide (CAS 2904682-19-3) is a chemical compound with the molecular formula C25H17N3O2S and a molecular weight of 423.5 g/mol. IUPAC name: N-[[4-(1,3-benzoxazol-2-yl)phenyl]carbamothioyl]naphthalene-2-carboxamide. InChIKey: DRGVVUJKZXEUFA-UHFFFAOYSA-N.
| Molecular formula | C25H17N3O2S |
|---|---|
| Molecular weight | 423.5 g/mol |
| IUPAC name | N-[[4-(1,3-benzoxazol-2-yl)phenyl]carbamothioyl]naphthalene-2-carboxamide |
| InChIKey | DRGVVUJKZXEUFA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(=O)NC(=S)NC3=CC=C(C=C3)C4=NC5=CC=CC=C5O4 |
Computed by PubChem (NCBI)