CAS 1337532-14-5 appears in our catalog under these names: PERK-IN-6/ 99.78% (existing batch purity), PERK–IN–6, PERK-IN-6, PERK-IN-6, 99.82%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 5 mg.
1-[5-(4-amino-7-methylpyrrolo[2,3-d]pyrimidin-5-yl)-2,3-dihydroindol-1-yl]-2-(6-methyl-2-pyridinyl)ethanone (CAS 1337532-14-5) is a chemical compound with the molecular formula C23H22N6O and a molecular weight of 398.5 g/mol. IUPAC name: 1-[5-(4-amino-7-methylpyrrolo[2,3-d]pyrimidin-5-yl)-2,3-dihydroindol-1-yl]-2-(6-methyl-2-pyridinyl)ethanone. InChIKey: VYZYOJULVVGQRS-UHFFFAOYSA-N.
| Molecular formula | C23H22N6O |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | 1-[5-(4-amino-7-methylpyrrolo[2,3-d]pyrimidin-5-yl)-2,3-dihydroindol-1-yl]-2-(6-methyl-2-pyridinyl)ethanone |
| InChIKey | VYZYOJULVVGQRS-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)CC(=O)N2CCC3=C2C=CC(=C3)C4=CN(C5=NC=NC(=C45)N)C |
Computed by PubChem (NCBI)