CAS 875051-72-2 appears in our catalog under these names: PF-01247324/ 99.47% (existing batch purity), PF–01247324, PF-01247324 98%, 6-Amino-N-methyl-5-(2,3,5-trichlorophenyl)picolinamide, PF-01247324, 99.77%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 1mg.
6-amino-N-methyl-5-(2,3,5-trichlorophenyl)pyridine-2-carboxamide (CAS 875051-72-2) is a chemical compound with the molecular formula C13H10Cl3N3O and a molecular weight of 330.6 g/mol. IUPAC name: 6-amino-N-methyl-5-(2,3,5-trichlorophenyl)pyridine-2-carboxamide. InChIKey: HPIUHDCRVYDAEJ-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl3N3O |
|---|---|
| Molecular weight | 330.6 g/mol |
| IUPAC name | 6-amino-N-methyl-5-(2,3,5-trichlorophenyl)pyridine-2-carboxamide |
| InChIKey | HPIUHDCRVYDAEJ-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=NC(=C(C=C1)C2=C(C(=CC(=C2)Cl)Cl)Cl)N |
Computed by PubChem (NCBI)