CAS 1305115-80-3 appears in our catalog under these names: PF-04957325/ 99.02% (existing batch purity), PF–04957325, PF-04957325, PF-04957325, 99.02% ,, 99.02% ,, PF-04957325, 99.55%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 100 mg.
3-[[(2R)-4-(1,3-thiazol-2-ylmethyl)morpholin-2-yl]methyl]-5-(trifluoromethyl)triazolo[4,5-d]pyrimidin-7-amine (CAS 1305115-80-3) is a chemical compound with the molecular formula C14H15F3N8OS and a molecular weight of 400.38 g/mol. IUPAC name: 3-[[(2R)-4-(1,3-thiazol-2-ylmethyl)morpholin-2-yl]methyl]-5-(trifluoromethyl)triazolo[4,5-d]pyrimidin-7-amine. InChIKey: VNLPYEMGHGDRRZ-MRVPVSSYSA-N.
| Molecular formula | C14H15F3N8OS |
|---|---|
| Molecular weight | 400.38 g/mol |
| IUPAC name | 3-[[(2R)-4-(1,3-thiazol-2-ylmethyl)morpholin-2-yl]methyl]-5-(trifluoromethyl)triazolo[4,5-d]pyrimidin-7-amine |
| InChIKey | VNLPYEMGHGDRRZ-MRVPVSSYSA-N |
| SMILES | C1CO[C@H](CN1CC2=NC=CS2)CN3C4=NC(=NC(=C4N=N3)N)C(F)(F)F |
Computed by PubChem (NCBI)