Products 1398583-31-7
CAS 1398583-31-7 appears in our catalog under these names: PF-05105679/ 99.82% (existing batch purity), PF–05105679, PF 05105679, PF-05105679 98%, (R)-3-((N-(1-(4-Fluorophenyl)ethyl)quinoline-3-carboxamido)methyl)benzoic acid, 98%, 98%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
3-[[[(1R)-1-(4-fluorophenyl)ethyl]-(quinoline-3-carbonyl)amino]methyl]benzoic acid (CAS 1398583-31-7) is a chemical compound with the molecular formula C26H21FN2O3 and a molecular weight of 428.5 g/mol. IUPAC name: 3-[[[(1R)-1-(4-fluorophenyl)ethyl]-(quinoline-3-carbonyl)amino]methyl]benzoic acid. InChIKey: BXNMZRPTQFVRFA-QGZVFWFLSA-N.
| Molecular formula | C26H21FN2O3 |
|---|---|
| Molecular weight | 428.5 g/mol |
| IUPAC name | 3-[[[(1R)-1-(4-fluorophenyl)ethyl]-(quinoline-3-carbonyl)amino]methyl]benzoic acid |
| InChIKey | BXNMZRPTQFVRFA-QGZVFWFLSA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)F)N(CC2=CC(=CC=C2)C(=O)O)C(=O)C3=CC4=CC=CC=C4N=C3 |
Computed by PubChem (NCBI)