CAS 1393124-08-7 appears in our catalog under these names: PF-06291874/ 99.14% (existing batch purity), Glucagon receptor antagonists–4, PF-06291874, PF-06291874 98+%, glucagon receptor antagonists-4, 98+%, 98+%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, 10mg, 1mg, 100mg, 50mg, 25mg, 250mg, 50 mg.
3-[[4-[(1S)-1-[3,5-dimethyl-4-[4-(trifluoromethyl)pyrazol-1-yl]phenoxy]butyl]benzoyl]amino]propanoic acid (CAS 1393124-08-7) is a chemical compound with the molecular formula C26H28F3N3O4 and a molecular weight of 503.5 g/mol. IUPAC name: 3-[[4-[(1S)-1-[3,5-dimethyl-4-[4-(trifluoromethyl)pyrazol-1-yl]phenoxy]butyl]benzoyl]amino]propanoic acid. InChIKey: IBDYYOQKQCCSDP-QFIPXVFZSA-N.
| Molecular formula | C26H28F3N3O4 |
|---|---|
| Molecular weight | 503.5 g/mol |
| IUPAC name | 3-[[4-[(1S)-1-[3,5-dimethyl-4-[4-(trifluoromethyl)pyrazol-1-yl]phenoxy]butyl]benzoyl]amino]propanoic acid |
| InChIKey | IBDYYOQKQCCSDP-QFIPXVFZSA-N |
| SMILES | CCC[C@@H](C1=CC=C(C=C1)C(=O)NCCC(=O)O)OC2=CC(=C(C(=C2)C)N3C=C(C=N3)C(F)(F)F)C |
Computed by PubChem (NCBI)