CAS 1467059-70-6 appears in our catalog under these names: 6-Chloro-5-(6-(dimethylamino)-2-methoxypyridin-3-yl)-1H-indole-3-carboxylic acid, PF-249/ 97.02% (existing batch purity), PF–06685249, PF-06685249, 98.00%. Offered by: Chemat, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 50mg, 100mg, 200mg, 1mg, 5mg, 10mg, 25mg, 5 mg.
6-chloro-5-[6-(dimethylamino)-2-methoxy-3-pyridinyl]-1H-indole-3-carboxylic acid (CAS 1467059-70-6) is a chemical compound with the molecular formula C17H16ClN3O3 and a molecular weight of 345.8 g/mol. IUPAC name: 6-chloro-5-[6-(dimethylamino)-2-methoxy-3-pyridinyl]-1H-indole-3-carboxylic acid. InChIKey: MJHBRTGGZYSCHJ-UHFFFAOYSA-N.
| Molecular formula | C17H16ClN3O3 |
|---|---|
| Molecular weight | 345.8 g/mol |
| IUPAC name | 6-chloro-5-[6-(dimethylamino)-2-methoxy-3-pyridinyl]-1H-indole-3-carboxylic acid |
| InChIKey | MJHBRTGGZYSCHJ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC(=C(C=C1)C2=C(C=C3C(=C2)C(=CN3)C(=O)O)Cl)OC |
Computed by PubChem (NCBI)