Products 1352879-65-2
CAS 1352879-65-2 appears in our catalog under these names: (S)-N-Methyl-2-(2-(2-methyl-1H-indol-3-yl)acetamido)-N,3-diphenylpropanamide, 99%, 99%, PF-3450074/ 99.92% (existing batch purity), PF–3450074, PF-3450074, PF-3450074 99%. Offered by: Chemat, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g, 10mg, 25mg, 200mg, 10mM (in 1ml dmso).
(2S)-N-methyl-2-[[2-(2-methyl-1H-indol-3-yl)acetyl]amino]-N,3-diphenylpropanamide (CAS 1352879-65-2) is a chemical compound with the molecular formula C27H27N3O2 and a molecular weight of 425.5 g/mol. IUPAC name: (2S)-N-methyl-2-[[2-(2-methyl-1H-indol-3-yl)acetyl]amino]-N,3-diphenylpropanamide. InChIKey: ACDFWSNAQWFRRF-VWLOTQADSA-N.
| Molecular formula | C27H27N3O2 |
|---|---|
| Molecular weight | 425.5 g/mol |
| IUPAC name | (2S)-N-methyl-2-[[2-(2-methyl-1H-indol-3-yl)acetyl]amino]-N,3-diphenylpropanamide |
| InChIKey | ACDFWSNAQWFRRF-VWLOTQADSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N1)CC(=O)N[C@@H](CC3=CC=CC=C3)C(=O)N(C)C4=CC=CC=C4 |
Computed by PubChem (NCBI)