CAS 1029317-21-2 appears in our catalog under these names: PF-4191834/ 99.77% (existing batch purity), PF-4191834, PF-4191834 99%, PF-4191834, 99.77%. Offered by: TargetMol, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1mg, 5 mg.
4-[3-[4-(2-methylpyrazol-3-yl)phenyl]sulfanylphenyl]oxane-4-carboxamide (CAS 1029317-21-2) is a chemical compound with the molecular formula C22H23N3O2S and a molecular weight of 393.5 g/mol. IUPAC name: 4-[3-[4-(2-methylpyrazol-3-yl)phenyl]sulfanylphenyl]oxane-4-carboxamide. InChIKey: DVNQWYLVSNPCJZ-UHFFFAOYSA-N.
| Molecular formula | C22H23N3O2S |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | 4-[3-[4-(2-methylpyrazol-3-yl)phenyl]sulfanylphenyl]oxane-4-carboxamide |
| InChIKey | DVNQWYLVSNPCJZ-UHFFFAOYSA-N |
| SMILES | CN1C(=CC=N1)C2=CC=C(C=C2)SC3=CC=CC(=C3)C4(CCOCC4)C(=O)N |
Computed by PubChem (NCBI)