CAS 1276553-09-3 appears in our catalog under these names: PF–4989216, PF-4989216/ 99.53% (existing batch purity), PF-4989216, PF-4989216, 99.38%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 25mg, 5mg, 2mg, 10mg, 50mg, 200mg, 1mg.
4-(4-cyano-2-fluorophenyl)-2-morpholin-4-yl-5-(1H-1,2,4-triazol-5-yl)thiophene-3-carbonitrile (CAS 1276553-09-3) is a chemical compound with the molecular formula C18H13FN6OS and a molecular weight of 380.4 g/mol. IUPAC name: 4-(4-cyano-2-fluorophenyl)-2-morpholin-4-yl-5-(1H-1,2,4-triazol-5-yl)thiophene-3-carbonitrile. InChIKey: MUENOTXSRZEFJV-UHFFFAOYSA-N.
| Molecular formula | C18H13FN6OS |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | 4-(4-cyano-2-fluorophenyl)-2-morpholin-4-yl-5-(1H-1,2,4-triazol-5-yl)thiophene-3-carbonitrile |
| InChIKey | MUENOTXSRZEFJV-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C(=C(S2)C3=NC=NN3)C4=C(C=C(C=C4)C#N)F)C#N |
Computed by PubChem (NCBI)