CAS 1035638-91-5 appears in our catalog under these names: PF–6274484, PF-6274484/ 99.12% (existing batch purity), PF-6274484, PF 6274484, 98%, 98%, PF-6274484, 98.76%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 2mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1mg.
N-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]prop-2-enamide (CAS 1035638-91-5) is a chemical compound with the molecular formula C18H14ClFN4O2 and a molecular weight of 372.8 g/mol. IUPAC name: N-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]prop-2-enamide. InChIKey: TUYDDIWQXWTNSW-UHFFFAOYSA-N.
| Molecular formula | C18H14ClFN4O2 |
|---|---|
| Molecular weight | 372.8 g/mol |
| IUPAC name | N-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]prop-2-enamide |
| InChIKey | TUYDDIWQXWTNSW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)N=CN=C2NC3=CC(=C(C=C3)F)Cl)NC(=O)C=C |
Computed by PubChem (NCBI)