CAS 1221971-47-6 appears in our catalog under these names: PF-9184/ 97.64% (existing batch purity), PF–9184, PF-03549184, PF-9184, PF-9184, 98.10%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 10 mg, 50 mg, 5 mg.
N-[4-(3,4-dichlorophenyl)phenyl]-4-hydroxy-1,1-dioxo-2H-1lambda6,2-benzothiazine-3-carboxamide (CAS 1221971-47-6) is a chemical compound with the molecular formula C21H14Cl2N2O4S and a molecular weight of 461.3 g/mol. IUPAC name: N-[4-(3,4-dichlorophenyl)phenyl]-4-hydroxy-1,1-dioxo-2H-1lambda6,2-benzothiazine-3-carboxamide. InChIKey: VGACSWBJQLLJFB-UHFFFAOYSA-N.
| Molecular formula | C21H14Cl2N2O4S |
|---|---|
| Molecular weight | 461.3 g/mol |
| IUPAC name | N-[4-(3,4-dichlorophenyl)phenyl]-4-hydroxy-1,1-dioxo-2H-1lambda6,2-benzothiazine-3-carboxamide |
| InChIKey | VGACSWBJQLLJFB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(NS2(=O)=O)C(=O)NC3=CC=C(C=C3)C4=CC(=C(C=C4)Cl)Cl)O |
Computed by PubChem (NCBI)