CAS 72882-78-1 appears in our catalog under these names: 2-(7-Chloro-5-phenyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)-N,N-dimethylethan-1-amine, 98%, PF-9366/ 98.99% (existing batch purity), PF–9366, PF 9366, PF-9366 98%. Offered by: Fluorochem, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g, 1mg.
2-(7-chloro-5-phenyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)-N,N-dimethylethanamine (CAS 72882-78-1) is a chemical compound with the molecular formula C20H19ClN4 and a molecular weight of 350.8 g/mol. IUPAC name: 2-(7-chloro-5-phenyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)-N,N-dimethylethanamine. InChIKey: LYLASWLQCMKZAT-UHFFFAOYSA-N.
| Molecular formula | C20H19ClN4 |
|---|---|
| Molecular weight | 350.8 g/mol |
| IUPAC name | 2-(7-chloro-5-phenyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)-N,N-dimethylethanamine |
| InChIKey | LYLASWLQCMKZAT-UHFFFAOYSA-N |
| SMILES | CN(C)CCC1=NN=C2N1C3=C(C=C(C=C3)Cl)C(=C2)C4=CC=CC=C4 |
Computed by PubChem (NCBI)