Products 853138-65-5
CAS 853138-65-5 appears in our catalog under these names: PG 01, PG01/ 99.87% (existing batch purity), PG01, PG01, 98%, 98%, PG01, 98.04%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 500mg, 2mg.
2-[[2-(1H-indol-3-yl)acetyl]-methylamino]-2-phenyl-N-(4-propan-2-ylphenyl)acetamide (CAS 853138-65-5) is a chemical compound with the molecular formula C28H29N3O2 and a molecular weight of 439.5 g/mol. IUPAC name: 2-[[2-(1H-indol-3-yl)acetyl]-methylamino]-2-phenyl-N-(4-propan-2-ylphenyl)acetamide. InChIKey: PQAYCXMQTUEDRD-UHFFFAOYSA-N.
| Molecular formula | C28H29N3O2 |
|---|---|
| Molecular weight | 439.5 g/mol |
| IUPAC name | 2-[[2-(1H-indol-3-yl)acetyl]-methylamino]-2-phenyl-N-(4-propan-2-ylphenyl)acetamide |
| InChIKey | PQAYCXMQTUEDRD-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)NC(=O)C(C2=CC=CC=C2)N(C)C(=O)CC3=CNC4=CC=CC=C43 |
Computed by PubChem (NCBI)