CAS 1311174-68-1 appears in our catalog under these names: PH-002/ 99.36% (existing batch purity), PH–002, PH-002, ApoE4 Modulator, PH002 1PC X 10MG, 1-Piperazinecarboxylic acid, 4-[[4-[[2-(3,4-dihydro-3-methyl-4-oxo-1-phthalazinyl)acetyl]amino]phenyl]methyl]-, 1,1-dimethylethyl ester, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 10 mg.
Tert-butyl 4-[[4-[[2-(3-methyl-4-oxophthalazin-1-yl)acetyl]amino]phenyl]methyl]piperazine-1-carboxylate (CAS 1311174-68-1) is a chemical compound with the molecular formula C27H33N5O4 and a molecular weight of 491.6 g/mol. IUPAC name: tert-butyl 4-[[4-[[2-(3-methyl-4-oxophthalazin-1-yl)acetyl]amino]phenyl]methyl]piperazine-1-carboxylate. InChIKey: GSXXTLWPQMHHDJ-UHFFFAOYSA-N.
| Molecular formula | C27H33N5O4 |
|---|---|
| Molecular weight | 491.6 g/mol |
| IUPAC name | tert-butyl 4-[[4-[[2-(3-methyl-4-oxophthalazin-1-yl)acetyl]amino]phenyl]methyl]piperazine-1-carboxylate |
| InChIKey | GSXXTLWPQMHHDJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)CC2=CC=C(C=C2)NC(=O)CC3=NN(C(=O)C4=CC=CC=C43)C |
Computed by PubChem (NCBI)