Products 398493-79-3
CAS 398493-79-3 appears in our catalog under these names: PHA–680632, PHA-680632/ 99.03% (existing batch purity), PHA-680632, PHA-680632, 99% (HPLC), 99% (HPLC), PHA-680632, 98.07%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 200mg, 5mg, 50mg, 25mg, 100mg, 1mg, 100 mg.
N-(2,6-diethylphenyl)-3-[[4-(4-methylpiperazin-1-yl)benzoyl]amino]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxamide (CAS 398493-79-3) is a chemical compound with the molecular formula C28H35N7O2 and a molecular weight of 501.6 g/mol. IUPAC name: N-(2,6-diethylphenyl)-3-[[4-(4-methylpiperazin-1-yl)benzoyl]amino]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxamide. InChIKey: OBWNXGOQPLDDPS-UHFFFAOYSA-N.
| Molecular formula | C28H35N7O2 |
|---|---|
| Molecular weight | 501.6 g/mol |
| IUPAC name | N-(2,6-diethylphenyl)-3-[[4-(4-methylpiperazin-1-yl)benzoyl]amino]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxamide |
| InChIKey | OBWNXGOQPLDDPS-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=CC=C1)CC)NC(=O)N2CC3=C(C2)NN=C3NC(=O)C4=CC=C(C=C4)N5CCN(CC5)C |
Computed by PubChem (NCBI)