CAS 2127107-15-5 appears in our catalog under these names: PHI–101, PHI-101/ 99.4% (existing batch purity), PHI-101 98%, Lasmotinib, 98.16%, (S)-5-((3-Fluorophenyl)ethynyl)-N-(piperidin-3-yl)-3-ureidothiophene-2-carboxamide, 98%, 98%. Offered by: GLPBio, TargetMol, Ambeed, MedChemExpress, Chemat. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 250mg.
3-(carbamoylamino)-5-[2-(3-fluorophenyl)ethynyl]-N-[(3S)-piperidin-3-yl]thiophene-2-carboxamide (CAS 2127107-15-5) is a chemical compound with the molecular formula C19H19FN4O2S and a molecular weight of 386.4 g/mol. IUPAC name: 3-(carbamoylamino)-5-[2-(3-fluorophenyl)ethynyl]-N-[(3S)-piperidin-3-yl]thiophene-2-carboxamide. InChIKey: ULVAGWVTXBTFRN-AWEZNQCLSA-N.
| Molecular formula | C19H19FN4O2S |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | 3-(carbamoylamino)-5-[2-(3-fluorophenyl)ethynyl]-N-[(3S)-piperidin-3-yl]thiophene-2-carboxamide |
| InChIKey | ULVAGWVTXBTFRN-AWEZNQCLSA-N |
| SMILES | C1C[C@@H](CNC1)NC(=O)C2=C(C=C(S2)C#CC3=CC(=CC=C3)F)NC(=O)N |
Computed by PubChem (NCBI)