CAS 314291-83-3 appears in our catalog under these names: PHPS1/ 99.77% (existing batch purity), PHPS1, PTP Inhibitor V, PHPS1, PHPS1 98%, PHPS1, 98%, 98%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
4-[[5-(4-nitrophenyl)-3-oxo-2-phenyl-1H-pyrazol-4-yl]diazenyl]benzenesulfonic acid (CAS 314291-83-3) is a chemical compound with the molecular formula C21H15N5O6S and a molecular weight of 465.4 g/mol. IUPAC name: 4-[[5-(4-nitrophenyl)-3-oxo-2-phenyl-1H-pyrazol-4-yl]diazenyl]benzenesulfonic acid. InChIKey: IYPHPQODKSHEHV-UHFFFAOYSA-N.
| Molecular formula | C21H15N5O6S |
|---|---|
| Molecular weight | 465.4 g/mol |
| IUPAC name | 4-[[5-(4-nitrophenyl)-3-oxo-2-phenyl-1H-pyrazol-4-yl]diazenyl]benzenesulfonic acid |
| InChIKey | IYPHPQODKSHEHV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C(=C(N2)C3=CC=C(C=C3)[N+](=O)[O-])N=NC4=CC=C(C=C4)S(=O)(=O)O |
Computed by PubChem (NCBI)