CAS 925069-34-7 appears in our catalog under these names: PI-273/ 98.04% (existing batch purity), PI–273, 2-({((4-Chlorophenyl)carbonyl)carbamothioyl}amino)-4-ethyl-5-methylthiophene-3-carboxamide, PI-273, 99+%, 99+%, PI-273, 98.47%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso).
2-[(4-chlorobenzoyl)carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxamide (CAS 925069-34-7) is a chemical compound with the molecular formula C16H16ClN3O2S2 and a molecular weight of 381.9 g/mol. IUPAC name: 2-[(4-chlorobenzoyl)carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxamide. InChIKey: MIERMBQDBLFAFW-UHFFFAOYSA-N.
| Molecular formula | C16H16ClN3O2S2 |
|---|---|
| Molecular weight | 381.9 g/mol |
| IUPAC name | 2-[(4-chlorobenzoyl)carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxamide |
| InChIKey | MIERMBQDBLFAFW-UHFFFAOYSA-N |
| SMILES | CCC1=C(SC(=C1C(=O)N)NC(=S)NC(=O)C2=CC=C(C=C2)Cl)C |
Computed by PubChem (NCBI)