CAS 2757804-89-8 appears in our catalog under these names: PI3K/Akt/mTOR-IN-2/ 99.61% (existing batch purity), PI3K/Akt/mTOR–IN–2, PI3K/Akt/mTOR-IN-2 99%, 1-(3,5-Difluorophenyl)-1,3,4,9-tetrahydropyrano[3,4-b]indole, PI3K/Akt/mTOR-IN-2, 99.93%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
1-(3,5-difluorophenyl)-1,3,4,9-tetrahydropyrano[3,4-b]indole (CAS 2757804-89-8) is a chemical compound with the molecular formula C17H13F2NO and a molecular weight of 285.29 g/mol. IUPAC name: 1-(3,5-difluorophenyl)-1,3,4,9-tetrahydropyrano[3,4-b]indole. InChIKey: XBYJYKHTEFYLFX-UHFFFAOYSA-N.
| Molecular formula | C17H13F2NO |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | 1-(3,5-difluorophenyl)-1,3,4,9-tetrahydropyrano[3,4-b]indole |
| InChIKey | XBYJYKHTEFYLFX-UHFFFAOYSA-N |
| SMILES | C1COC(C2=C1C3=CC=CC=C3N2)C4=CC(=CC(=C4)F)F |
Computed by PubChem (NCBI)