CAS 2766854-03-7 appears in our catalog under these names: PI5P4Ks-IN-2/ 99.21% (existing batch purity), PI5P4Ks–IN–2, PI5P4Ks-IN-2, PI5P4Ks-IN-2, 99.78%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 10mM/1mL.
5-methyl-2-(2-propan-2-ylphenyl)-N-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-4-amine (CAS 2766854-03-7) is a chemical compound with the molecular formula C22H23N5 and a molecular weight of 357.5 g/mol. IUPAC name: 5-methyl-2-(2-propan-2-ylphenyl)-N-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-4-amine. InChIKey: XIEZMAUGHWKZDR-UHFFFAOYSA-N.
| Molecular formula | C22H23N5 |
|---|---|
| Molecular weight | 357.5 g/mol |
| IUPAC name | 5-methyl-2-(2-propan-2-ylphenyl)-N-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-4-amine |
| InChIKey | XIEZMAUGHWKZDR-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=CC=C1C2=NC3=C(C(=N2)NCC4=CC=CC=N4)N(C=C3)C |
Computed by PubChem (NCBI)