Products 593960-11-3
CAS 593960-11-3 appears in our catalog under these names: PIK-93/ 99.83% (existing batch purity), PIK–93, PIK 93, PIK-93, PIK-93 98%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, Ambeed. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
N-[5-[4-chloro-3-(2-hydroxyethylsulfamoyl)phenyl]-4-methyl-1,3-thiazol-2-yl]acetamide (CAS 593960-11-3) is a chemical compound with the molecular formula C14H16ClN3O4S2 and a molecular weight of 389.9 g/mol. IUPAC name: N-[5-[4-chloro-3-(2-hydroxyethylsulfamoyl)phenyl]-4-methyl-1,3-thiazol-2-yl]acetamide. InChIKey: JFVNFXCESCXMBC-UHFFFAOYSA-N.
| Molecular formula | C14H16ClN3O4S2 |
|---|---|
| Molecular weight | 389.9 g/mol |
| IUPAC name | N-[5-[4-chloro-3-(2-hydroxyethylsulfamoyl)phenyl]-4-methyl-1,3-thiazol-2-yl]acetamide |
| InChIKey | JFVNFXCESCXMBC-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)NC(=O)C)C2=CC(=C(C=C2)Cl)S(=O)(=O)NCCO |
Computed by PubChem (NCBI)