cas: 487-36-5 — see every product listed under this CAS number, including other names
PINORESINOL, 95% (CAS 487-36-5) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 25mg, 50mg, 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F840991-1MG |
| cas | 487-36-5 |
| size | 1mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1mg | 185.37 Pln | |
| Fluorochem | 25mg | 1138.16 Pln | |
| Fluorochem | 50mg | 1762.94 Pln | |
| Fluorochem | 100mg | 2783.41 Pln | |
| Fluorochem | 250mg | 4876.43 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(+)-pinoresinol is an enantiomer of pinoresinol having (+)-1S,3aR,4S,6aR-configuration. It has a role as a hypoglycemic agent, a plant metabolite and a phytoestrogen.
Source: ChEBI
| Molecular formula | C20H22O6 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | 4-[(3S,3aR,6S,6aR)-6-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenol |
| InChIKey | HGXBRUKMWQGOIE-AFHBHXEDSA-N |
| SMILES | COC1=C(C=CC(=C1)[C@@H]2[C@H]3CO[C@@H]([C@H]3CO2)C4=CC(=C(C=C4)O)OC)O |
Computed by PubChem (NCBI)