cas: 918435-70-8 — see every product listed under this CAS number, including other names
PIPERAZINE-1,2-DICARBOXYLIC ACID 1-(9H-FLUOREN-9-YLMETHYL) ESTER, 95%, 95% (CAS 918435-70-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117F4R-100mg |
| cas | 918435-70-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 741.20 Pln | |
| Chemat | 250mg | 1288.40 Pln | |
| Chemat | 500mg | 2013.20 Pln | |
| Chemat | 1g | 3654.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(9H-fluoren-9-ylmethoxycarbonyl)piperazine-2-carboxylic acid (CAS 918435-70-8) is a chemical compound with the molecular formula C20H20N2O4 and a molecular weight of 352.4 g/mol. IUPAC name: 1-(9H-fluoren-9-ylmethoxycarbonyl)piperazine-2-carboxylic acid. InChIKey: RKXKKKUNIBLRES-UHFFFAOYSA-N.
| Molecular formula | C20H20N2O4 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | 1-(9H-fluoren-9-ylmethoxycarbonyl)piperazine-2-carboxylic acid |
| InChIKey | RKXKKKUNIBLRES-UHFFFAOYSA-N |
| SMILES | C1CN(C(CN1)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)