CAS 2165324-62-7 appears in our catalog under these names: PK150/ 99.43% (existing batch purity), PK150, PK150 (Sorafenib Analog), PK150 99%, 1-(4-Chloro-3-(trifluoromethyl)phenyl)-3-(2,2-difluorobenzo[d][1,3]dioxol-5-yl)urea, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, Ambeed. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 250mg.
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(2,2-difluoro-1,3-benzodioxol-5-yl)urea (CAS 2165324-62-7) is a chemical compound with the molecular formula C15H8ClF5N2O3 and a molecular weight of 394.68 g/mol. IUPAC name: 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(2,2-difluoro-1,3-benzodioxol-5-yl)urea. InChIKey: SHPYXCLUNMOJOB-UHFFFAOYSA-N.
| Molecular formula | C15H8ClF5N2O3 |
|---|---|
| Molecular weight | 394.68 g/mol |
| IUPAC name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(2,2-difluoro-1,3-benzodioxol-5-yl)urea |
| InChIKey | SHPYXCLUNMOJOB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1NC(=O)NC3=CC(=C(C=C3)Cl)C(F)(F)F)OC(O2)(F)F |
Computed by PubChem (NCBI)