Products 1628428-01-2
CAS 1628428-01-2 appears in our catalog under these names: PKR–IN–2, PKR-IN-2, PKR-IN-2/ 99.17% (existing batch purity), PKR activator 3 98+%, PKR activator 3, 99.82%. Offered by: GLPBio, Chemat, TargetMol, Ambeed, MedChemExpress. Available pack sizes: 10mg, 100mg, 10mM (in 1ml dmso), 5mg, 50mg, 1mg, 25mg, 200mg.
N-[4-[4-hydroxy-4-(2-methylpropyl)piperidine-1-carbonyl]phenyl]quinoxaline-5-sulfonamide (CAS 1628428-01-2) is a chemical compound with the molecular formula C24H28N4O4S and a molecular weight of 468.6 g/mol. IUPAC name: N-[4-[4-hydroxy-4-(2-methylpropyl)piperidine-1-carbonyl]phenyl]quinoxaline-5-sulfonamide. InChIKey: JTGUGSWLWPKCGF-UHFFFAOYSA-N.
| Molecular formula | C24H28N4O4S |
|---|---|
| Molecular weight | 468.6 g/mol |
| IUPAC name | N-[4-[4-hydroxy-4-(2-methylpropyl)piperidine-1-carbonyl]phenyl]quinoxaline-5-sulfonamide |
| InChIKey | JTGUGSWLWPKCGF-UHFFFAOYSA-N |
| SMILES | CC(C)CC1(CCN(CC1)C(=O)C2=CC=C(C=C2)NS(=O)(=O)C3=CC=CC4=NC=CN=C43)O |
Computed by PubChem (NCBI)