PND-1186, 98%
cas: 1061353-68-1 — see every product listed under this CAS number, including other names
PND-1186, 98% (CAS 1061353-68-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 1mg, 2mg, 5mg, 100mg. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A103079-250mg |
| cas | 1061353-68-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1093.50 Pln | |
| Ambeed | 1g | 2695.50 Pln | |
| Ambeed | 5g | 10566.44 Pln | |
| Chemat | 1mg | 141.20 Pln | |
| Chemat | 2mg | 165.20 Pln | |
| Chemat | 5mg | 194.00 Pln | |
| Chemat | 100mg | 515.60 Pln | |
| Chemat | 250mg | 832.40 Pln | |
| Chemat | 1g | 2070.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-[[2-(2-methoxy-4-morpholin-4-ylanilino)-5-(trifluoromethyl)-4-pyridinyl]amino]-N-methylbenzamide (CAS 1061353-68-1) is a chemical compound with the molecular formula C25H26F3N5O3 and a molecular weight of 501.5 g/mol. IUPAC name: 2-[[2-(2-methoxy-4-morpholin-4-ylanilino)-5-(trifluoromethyl)-4-pyridinyl]amino]-N-methylbenzamide. InChIKey: IGUBBWJDMLCRIK-UHFFFAOYSA-N.
| Molecular formula | C25H26F3N5O3 |
|---|---|
| Molecular weight | 501.5 g/mol |
| IUPAC name | 2-[[2-(2-methoxy-4-morpholin-4-ylanilino)-5-(trifluoromethyl)-4-pyridinyl]amino]-N-methylbenzamide |
| InChIKey | IGUBBWJDMLCRIK-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC=CC=C1NC2=CC(=NC=C2C(F)(F)F)NC3=C(C=C(C=C3)N4CCOCC4)OC |
Computed by PubChem (NCBI)