Products 1061353-68-1
CAS 1061353-68-1 appears in our catalog under these names: PND–1186, PND-1186 (VS-4718), PND-1186/ 99.75% (existing batch purity), PND 1186, PND-1186 98%. Offered by: GLPBio, Chemat Brand, TargetMol, Biosynth, Ambeed. Available pack sizes: 1mg, on request, 5mg, 10mg, 50mg, 100mg, 25mg, 10mM (in 1ml dmso).
2-[[2-(2-methoxy-4-morpholin-4-ylanilino)-5-(trifluoromethyl)-4-pyridinyl]amino]-N-methylbenzamide (CAS 1061353-68-1) is a chemical compound with the molecular formula C25H26F3N5O3 and a molecular weight of 501.5 g/mol. IUPAC name: 2-[[2-(2-methoxy-4-morpholin-4-ylanilino)-5-(trifluoromethyl)-4-pyridinyl]amino]-N-methylbenzamide. InChIKey: IGUBBWJDMLCRIK-UHFFFAOYSA-N.
| Molecular formula | C25H26F3N5O3 |
|---|---|
| Molecular weight | 501.5 g/mol |
| IUPAC name | 2-[[2-(2-methoxy-4-morpholin-4-ylanilino)-5-(trifluoromethyl)-4-pyridinyl]amino]-N-methylbenzamide |
| InChIKey | IGUBBWJDMLCRIK-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC=CC=C1NC2=CC(=NC=C2C(F)(F)F)NC3=C(C=C(C=C3)N4CCOCC4)OC |
Computed by PubChem (NCBI)