cas: 21886-12-4 — see every product listed under this CAS number, including other names
PNU112455A HCl 97% (CAS 21886-12-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A245488-1mg |
| cas | 21886-12-4 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 175.69 Pln | |
| Ambeed | 5mg | 292.50 Pln | |
| Ambeed | 10mg | 392.62 Pln | |
| Ambeed | 25mg | 609.56 Pln | |
| Ambeed | 50mg | 926.62 Pln | |
| Ambeed | 100mg | 1516.25 Pln | |
| Ambeed | 250mg | 2511.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A245488 |
4-[(6-aminopyrimidin-4-yl)amino]benzenesulfonamide;hydrochloride (CAS 21886-12-4) is a chemical compound with the molecular formula C10H12ClN5O2S and a molecular weight of 301.75 g/mol. IUPAC name: 4-[(6-aminopyrimidin-4-yl)amino]benzenesulfonamide;hydrochloride. InChIKey: XBXQRCJKDCEQBS-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN5O2S |
|---|---|
| Molecular weight | 301.75 g/mol |
| IUPAC name | 4-[(6-aminopyrimidin-4-yl)amino]benzenesulfonamide;hydrochloride |
| InChIKey | XBXQRCJKDCEQBS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=NC=NC(=C2)N)S(=O)(=O)N.Cl |
Computed by PubChem (NCBI)