CAS 21886-12-4 appears in our catalog under these names: 4-((6-AMINOPYRIMIDIN-4-YL)AMINO)BENZENESULFONAMIDE HYDROCHLORIDE, 97%, PNU112455A hydrochloride/ 100%, PNU112455A hydrochloride, PNU112455A HCl 97%, PNU 112455A hydrochloride, 97%, 97%. Offered by: Fluorochem, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 10mg, 25mg, 100mg, 250mg, 2mg, 5mg, 50mg, 500mg.
4-[(6-aminopyrimidin-4-yl)amino]benzenesulfonamide;hydrochloride (CAS 21886-12-4) is a chemical compound with the molecular formula C10H12ClN5O2S and a molecular weight of 301.75 g/mol. IUPAC name: 4-[(6-aminopyrimidin-4-yl)amino]benzenesulfonamide;hydrochloride. InChIKey: XBXQRCJKDCEQBS-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN5O2S |
|---|---|
| Molecular weight | 301.75 g/mol |
| IUPAC name | 4-[(6-aminopyrimidin-4-yl)amino]benzenesulfonamide;hydrochloride |
| InChIKey | XBXQRCJKDCEQBS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=NC=NC(=C2)N)S(=O)(=O)N.Cl |
Computed by PubChem (NCBI)