CAS 875634-01-8 appears in our catalog under these names: PPY A/ 98.77% (existing batch purity), PPY A, PPY A, 5-[3-(2-Methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-N,N-dimethyl-3-pyridinecarboxamide, 98.77% ,, 98.77% ,, PPY-A, 98.02%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 5 mg.
5-[3-(2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-N,N-dimethylpyridine-3-carboxamide (CAS 875634-01-8) is a chemical compound with the molecular formula C22H20N4O2 and a molecular weight of 372.4 g/mol. IUPAC name: 5-[3-(2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-N,N-dimethylpyridine-3-carboxamide. InChIKey: GYQRHHQPEMOLKH-UHFFFAOYSA-N.
| Molecular formula | C22H20N4O2 |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | 5-[3-(2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-N,N-dimethylpyridine-3-carboxamide |
| InChIKey | GYQRHHQPEMOLKH-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CN=CC(=C1)C2=CC3=C(NC=C3C4=CC=CC=C4OC)N=C2 |
Computed by PubChem (NCBI)