CAS 1194961-19-7 appears in our catalog under these names: PRT 060318, >95% (HPLC), PRT–060318, PRT-060318/ 98.82% (existing batch purity), PRT 060318, PRT-060318. Offered by: TRC, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 10mg, 1mg, 25mg, 100mg, 5mg, 10mM (in 1ml water), 50mg, 2mg.
2-[[(1R,2S)-2-aminocyclohexyl]amino]-4-(3-methylanilino)pyrimidine-5-carboxamide (CAS 1194961-19-7) is a chemical compound with the molecular formula C18H24N6O and a molecular weight of 340.4 g/mol. IUPAC name: 2-[[(1R,2S)-2-aminocyclohexyl]amino]-4-(3-methylanilino)pyrimidine-5-carboxamide. InChIKey: NZNTWOVDIXCHHS-LSDHHAIUSA-N.
| Molecular formula | C18H24N6O |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 2-[[(1R,2S)-2-aminocyclohexyl]amino]-4-(3-methylanilino)pyrimidine-5-carboxamide |
| InChIKey | NZNTWOVDIXCHHS-LSDHHAIUSA-N |
| SMILES | CC1=CC(=CC=C1)NC2=NC(=NC=C2C(=O)N)N[C@@H]3CCCC[C@@H]3N |
Computed by PubChem (NCBI)