CAS 215997-93-6 appears in our catalog under these names: PSB-15160/ 97.05% (existing batch purity), PSB-15160. Offered by: TargetMol, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg.
5-fluoro-3-[(5-fluoro-1H-indol-3-yl)methyl]-1H-indole (CAS 215997-93-6) is a chemical compound with the molecular formula C17H12F2N2 and a molecular weight of 282.29 g/mol. IUPAC name: 5-fluoro-3-[(5-fluoro-1H-indol-3-yl)methyl]-1H-indole. InChIKey: BEBUKYWOUXBVEE-UHFFFAOYSA-N.
| Molecular formula | C17H12F2N2 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | 5-fluoro-3-[(5-fluoro-1H-indol-3-yl)methyl]-1H-indole |
| InChIKey | BEBUKYWOUXBVEE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=CN2)CC3=CNC4=C3C=C(C=C4)F |
Computed by PubChem (NCBI)