CAS 1092351-10-4 appears in our catalog under these names: PSB 603, 8-[4-[[4-(4-Chlorophenyl)-1-piperazinyl]sulfonyl]phenyl]-3,9-dihydro-1-propyl-1H-purine-2,6-dione, 97.13% ,, 97.13% ,, PSB-603, 98%, PSB-603/ 97.13% (existing batch purity), PSB-603. Offered by: GLPBio, Chemat, AmBeed, TargetMol, Biosynth. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
8-[4-[4-(4-chlorophenyl)piperazin-1-yl]sulfonylphenyl]-1-propyl-3,7-dihydropurine-2,6-dione (CAS 1092351-10-4) is a chemical compound with the molecular formula C24H25ClN6O4S and a molecular weight of 529.0 g/mol. IUPAC name: 8-[4-[4-(4-chlorophenyl)piperazin-1-yl]sulfonylphenyl]-1-propyl-3,7-dihydropurine-2,6-dione. InChIKey: OVHCTHHFOHMNFV-UHFFFAOYSA-N.
| Molecular formula | C24H25ClN6O4S |
|---|---|
| Molecular weight | 529.0 g/mol |
| IUPAC name | 8-[4-[4-(4-chlorophenyl)piperazin-1-yl]sulfonylphenyl]-1-propyl-3,7-dihydropurine-2,6-dione |
| InChIKey | OVHCTHHFOHMNFV-UHFFFAOYSA-N |
| SMILES | CCCN1C(=O)C2=C(NC1=O)N=C(N2)C3=CC=C(C=C3)S(=O)(=O)N4CCN(CC4)C5=CC=C(C=C5)Cl |
Computed by PubChem (NCBI)