cas: 817204-33-4 — see every product listed under this CAS number, including other names
PSI-6130 99% (CAS 817204-33-4) is a chemical reagent available from Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A669372-2mg |
| cas | 817204-33-4 |
| size | 2mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 2mg | 353.69 Pln | |
| Ambeed | 5mg | 431.56 Pln | |
| Ambeed | 10mg | 515.00 Pln | |
| Ambeed | 25mg | 604.00 Pln | |
| Ambeed | 50mg | 854.31 Pln | |
| Ambeed | 100mg | 1388.31 Pln | |
| Ambeed | 250mg | 2556.44 Pln | |
| Ambeed | 1g | 6756.12 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A669372 |
4-amino-1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidin-2-one (CAS 817204-33-4) is a chemical compound with the molecular formula C10H14FN3O4 and a molecular weight of 259.23 g/mol. IUPAC name: 4-amino-1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidin-2-one. InChIKey: NYPIRLYMDJMKGW-VPCXQMTMSA-N.
| Molecular formula | C10H14FN3O4 |
|---|---|
| Molecular weight | 259.23 g/mol |
| IUPAC name | 4-amino-1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidin-2-one |
| InChIKey | NYPIRLYMDJMKGW-VPCXQMTMSA-N |
| SMILES | C[C@]1([C@@H]([C@H](O[C@H]1N2C=CC(=NC2=O)N)CO)O)F |
Computed by PubChem (NCBI)