CAS 817204-33-4 appears in our catalog under these names: Sofosbuvir Impurity 115, PSI 6130, >95% (HPLC), PSI-6130/ 99.36% (existing batch purity), 2'-Deoxy-2'-fluoro-2'-C-methylcytidine, PSI-6130 99%. Offered by: Chemat Brand, TRC, TargetMol, Biosynth, Ambeed. Available pack sizes: on request, 2,5mg, 25mg, 50mg, 1mg, 5mg, 10mg, 100mg.
4-amino-1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidin-2-one (CAS 817204-33-4) is a chemical compound with the molecular formula C10H14FN3O4 and a molecular weight of 259.23 g/mol. IUPAC name: 4-amino-1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidin-2-one. InChIKey: NYPIRLYMDJMKGW-VPCXQMTMSA-N.
| Molecular formula | C10H14FN3O4 |
|---|---|
| Molecular weight | 259.23 g/mol |
| IUPAC name | 4-amino-1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidin-2-one |
| InChIKey | NYPIRLYMDJMKGW-VPCXQMTMSA-N |
| SMILES | C[C@]1([C@@H]([C@H](O[C@H]1N2C=CC(=NC2=O)N)CO)O)F |
Computed by PubChem (NCBI)