cas: 863329-66-2 — see every product listed under this CAS number, including other names
PSI-6206 97% (CAS 863329-66-2) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 50mg, 100mg, 1g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A104802-1mg |
| cas | 863329-66-2 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 120.06 Pln | |
| Ambeed | 10mg | 131.19 Pln | |
| Ambeed | 50mg | 147.88 Pln | |
| Ambeed | 100mg | 164.56 Pln | |
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 10g | 242.44 Pln | |
| Ambeed | 25g | 303.62 Pln | |
| Ambeed | 100g | 976.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A104802 |
1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidine-2,4-dione (CAS 863329-66-2) is a chemical compound with the molecular formula C10H13FN2O5 and a molecular weight of 260.22 g/mol. IUPAC name: 1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidine-2,4-dione. InChIKey: ARKKGZQTGXJVKW-VPCXQMTMSA-N.
| Molecular formula | C10H13FN2O5 |
|---|---|
| Molecular weight | 260.22 g/mol |
| IUPAC name | 1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | ARKKGZQTGXJVKW-VPCXQMTMSA-N |
| SMILES | C[C@]1([C@@H]([C@H](O[C@H]1N2C=CC(=O)NC2=O)CO)O)F |
Computed by PubChem (NCBI)