CAS 877202-74-9 appears in our catalog under these names: PSNCBAM-1/ 98.18% (existing batch purity), PSNCBAM–1, PSNCBAM-1 99%, Psncbam-1, 99%, 99%, PSNCBAM-1, 99.48%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
1-(4-chlorophenyl)-3-[3-(6-pyrrolidin-1-yl-2-pyridinyl)phenyl]urea (CAS 877202-74-9) is a chemical compound with the molecular formula C22H21ClN4O and a molecular weight of 392.9 g/mol. IUPAC name: 1-(4-chlorophenyl)-3-[3-(6-pyrrolidin-1-yl-2-pyridinyl)phenyl]urea. InChIKey: HDAYFSFWIPRJSO-UHFFFAOYSA-N.
| Molecular formula | C22H21ClN4O |
|---|---|
| Molecular weight | 392.9 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-3-[3-(6-pyrrolidin-1-yl-2-pyridinyl)phenyl]urea |
| InChIKey | HDAYFSFWIPRJSO-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=CC=CC(=N2)C3=CC(=CC=C3)NC(=O)NC4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)