CAS 1782970-28-8 appears in our catalog under these names: PTC-028/ 98.25% (existing batch purity), PTC 028, PTC-028 99%, PTC-028, 99%, 99%, PTC-028, 98.0%. Offered by: TargetMol, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
6-(5,6-difluoro-2-methylbenzimidazol-1-yl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine (CAS 1782970-28-8) is a chemical compound with the molecular formula C19H12F5N5 and a molecular weight of 405.3 g/mol. IUPAC name: 6-(5,6-difluoro-2-methylbenzimidazol-1-yl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine. InChIKey: JEZGPBWIZWPDHP-UHFFFAOYSA-N.
| Molecular formula | C19H12F5N5 |
|---|---|
| Molecular weight | 405.3 g/mol |
| IUPAC name | 6-(5,6-difluoro-2-methylbenzimidazol-1-yl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine |
| InChIKey | JEZGPBWIZWPDHP-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC(=C(C=C2N1C3=NC(=CN=C3)NC4=CC=C(C=C4)C(F)(F)F)F)F |
Computed by PubChem (NCBI)