CAS 2407611-02-1 appears in our catalog under these names: PTPN2/1–IN–2, PTPN2/1-IN-2, 99.56%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10 mg, 5 mg, 1 mg.
5-[1-fluoro-3-hydroxy-7-(3-hydroxy-3-methylbutoxy)naphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (CAS 2407611-02-1) is a chemical compound with the molecular formula C17H19FN2O6S and a molecular weight of 398.4 g/mol. IUPAC name: 5-[1-fluoro-3-hydroxy-7-(3-hydroxy-3-methylbutoxy)naphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one. InChIKey: KJYRSQLWJMEJNM-UHFFFAOYSA-N.
| Molecular formula | C17H19FN2O6S |
|---|---|
| Molecular weight | 398.4 g/mol |
| IUPAC name | 5-[1-fluoro-3-hydroxy-7-(3-hydroxy-3-methylbutoxy)naphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| InChIKey | KJYRSQLWJMEJNM-UHFFFAOYSA-N |
| SMILES | CC(C)(CCOC1=CC2=C(C(=C(C=C2C=C1)O)N3CC(=O)NS3(=O)=O)F)O |
Computed by PubChem (NCBI)