CAS 98410-36-7 appears in our catalog under these names: Palatrigine/ 98.87% (existing batch purity), Palatrigine, BW A256C. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10 mg.
6-(2,3-dichlorophenyl)-3-imino-2-propan-2-yl-1,2,4-triazin-5-amine (CAS 98410-36-7) is a chemical compound with the molecular formula C12H13Cl2N5 and a molecular weight of 298.17 g/mol. IUPAC name: 6-(2,3-dichlorophenyl)-3-imino-2-propan-2-yl-1,2,4-triazin-5-amine. InChIKey: XJQJAFGEQVKYNF-UHFFFAOYSA-N.
| Molecular formula | C12H13Cl2N5 |
|---|---|
| Molecular weight | 298.17 g/mol |
| IUPAC name | 6-(2,3-dichlorophenyl)-3-imino-2-propan-2-yl-1,2,4-triazin-5-amine |
| InChIKey | XJQJAFGEQVKYNF-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=N)N=C(C(=N1)C2=C(C(=CC=C2)Cl)Cl)N |
Computed by PubChem (NCBI)