CAS 188396-77-2 appears in our catalog under these names: Paliroden/ 99.46% (existing batch purity), Paliroden (SR 57667), Paliroden, Paliroden, 98%, 98%, Paliroden, 96.26%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 20mg, 25mg, 50mg, 10 mg, 50 mg.
1-[2-(4-phenylphenyl)ethyl]-4-[3-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine (CAS 188396-77-2) is a chemical compound with the molecular formula C26H24F3N and a molecular weight of 407.5 g/mol. IUPAC name: 1-[2-(4-phenylphenyl)ethyl]-4-[3-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine. InChIKey: CNEWKIDCGDXBDE-UHFFFAOYSA-N.
| Molecular formula | C26H24F3N |
|---|---|
| Molecular weight | 407.5 g/mol |
| IUPAC name | 1-[2-(4-phenylphenyl)ethyl]-4-[3-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine |
| InChIKey | CNEWKIDCGDXBDE-UHFFFAOYSA-N |
| SMILES | C1CN(CC=C1C2=CC(=CC=C2)C(F)(F)F)CCC3=CC=C(C=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)