CAS 101001-34-7 appears in our catalog under these names: Pamicogrel/ 98.96% (existing batch purity), Pamicogrel (KBT3022), Ethyl 2-(2-(4,5-bis(4-methoxyphenyl)thiazol-2-yl)-1H-pyrrol-1-yl)acetate, Pamicogrel 99%, Pamicogrel, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 10mM (in 1ml dmso), 1mg.
Ethyl 2-[2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]pyrrol-1-yl]acetate (CAS 101001-34-7) is a chemical compound with the molecular formula C25H24N2O4S and a molecular weight of 448.5 g/mol. IUPAC name: ethyl 2-[2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]pyrrol-1-yl]acetate. InChIKey: ISCHOARKJADAKJ-UHFFFAOYSA-N.
| Molecular formula | C25H24N2O4S |
|---|---|
| Molecular weight | 448.5 g/mol |
| IUPAC name | ethyl 2-[2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]pyrrol-1-yl]acetate |
| InChIKey | ISCHOARKJADAKJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1C=CC=C1C2=NC(=C(S2)C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC |
Computed by PubChem (NCBI)